C9H10N4 — CID 104593302
3-(2,5-dihydropyrrol-1-yl)-1-methylpyrazole-4-carbonitrile (PubChem CID 104593302) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 3-(2,5-dihydropyrrol-1-yl)-1-methylpyrazole-4-carbonitrile.
| Compound Name | 3-(2,5-dihydropyrrol-1-yl)-1-methylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 104593302 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3-(2,5-dihydropyrrol-1-yl)-1-methylpyrazole-4-carbonitrile |
| SMILES | Cn1cc(C#N)c(N2CC=CC2)n1 |
| InChI | InChI=1S/C9H10N4/c1-12-7-8(6-10)9(11-12)13-4-2-3-5-13/h2-3,7H,4-5H2,1H3 |
| InChIKey | IFMLFSIAZAEANK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|