C10H15N5O — CID 104594134
3-[2-(2-hydroxypropylamino)ethylamino]pyrazine-2-carbonitrile (PubChem CID 104594134) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-[2-(2-hydroxypropylamino)ethylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[2-(2-hydroxypropylamino)ethylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 104594134 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 3-[2-(2-hydroxypropylamino)ethylamino]pyrazine-2-carbonitrile |
| SMILES | CC(O)CNCCNc1nccnc1C#N |
| InChI | InChI=1S/C10H15N5O/c1-8(16)7-12-2-3-14-10-9(6-11)13-4-5-15-10/h4-5,8,12,16H,2-3,7H2,1H3,(H,14,15) |
| InChIKey | KHKXDBCQKKYMQI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|