C12H21NO5S — CID 104595573
2-methyl-1-(oxolan-2-ylmethylsulfonyl)piperidine-2-carboxylic acid (PubChem CID 104595573) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-methyl-1-(oxolan-2-ylmethylsulfonyl)piperidine-2-carboxylic acid.
| Compound Name | 2-methyl-1-(oxolan-2-ylmethylsulfonyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 104595573 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-methyl-1-(oxolan-2-ylmethylsulfonyl)piperidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCCN1S(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C12H21NO5S/c1-12(11(14)15)6-2-3-7-13(12)19(16,17)9-10-5-4-8-18-10/h10H,2-9H2,1H3,(H,14,15) |
| InChIKey | WMAARBCICZVHFW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |