C11H21NO4S — CID 154789706
3,3-dimethyl-4-(oxolan-2-ylmethylsulfonyl)morpholine (PubChem CID 154789706) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 3,3-dimethyl-4-(oxolan-2-ylmethylsulfonyl)morpholine.
| Compound Name | 3,3-dimethyl-4-(oxolan-2-ylmethylsulfonyl)morpholine |
|---|---|
| PubChem CID | 154789706 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3,3-dimethyl-4-(oxolan-2-ylmethylsulfonyl)morpholine |
| SMILES | CC1(C)COCCN1S(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C11H21NO4S/c1-11(2)9-15-7-5-12(11)17(13,14)8-10-4-3-6-16-10/h10H,3-9H2,1-2H3 |
| InChIKey | YKZYTZVIDIJPTG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |