C12H21NO5S — CID 106742431
2-methyl-1-(oxolan-2-ylmethylsulfonyl)piperidine-4-carboxylic acid (PubChem CID 106742431) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-methyl-1-(oxolan-2-ylmethylsulfonyl)piperidine-4-carboxylic acid.
| Compound Name | 2-methyl-1-(oxolan-2-ylmethylsulfonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106742431 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-methyl-1-(oxolan-2-ylmethylsulfonyl)piperidine-4-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CCN1S(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C12H21NO5S/c1-9-7-10(12(14)15)4-5-13(9)19(16,17)8-11-3-2-6-18-11/h9-11H,2-8H2,1H3,(H,14,15) |
| InChIKey | VJMIEXCLUJYYBQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |