C10H17NO5S2 — CID 82901357
4-(oxolan-2-ylmethylsulfonyl)thiomorpholine-3-carboxylic acid (PubChem CID 82901357) has the molecular formula C10H17NO5S2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethylsulfonyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(oxolan-2-ylmethylsulfonyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82901357 |
| Molecular Formula | C10H17NO5S2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 4-(oxolan-2-ylmethylsulfonyl)thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1S(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C10H17NO5S2/c12-10(13)9-6-17-5-3-11(9)18(14,15)7-8-2-1-4-16-8/h8-9H,1-7H2,(H,12,13) |
| InChIKey | HXBZZVBVPYJFNQ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |