C7H10N2O3S2 — CID 104600574
2-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]-1,2-oxazolidine (PubChem CID 104600574) has the molecular formula C7H10N2O3S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]-1,2-oxazolidine.
| Compound Name | 2-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 104600574 |
| Molecular Formula | C7H10N2O3S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-5-yl)sulfonyl]-1,2-oxazolidine |
| SMILES | Cc1ncc(S(=O)(=O)N2CCCO2)s1 |
| InChI | InChI=1S/C7H10N2O3S2/c1-6-8-5-7(13-6)14(10,11)9-3-2-4-12-9/h5H,2-4H2,1H3 |
| InChIKey | JLJAOCUFRFTKCK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |