C7H6IN3S2 — CID 104602025
5-(5-iodothiophen-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione (PubChem CID 104602025) has the molecular formula C7H6IN3S2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 5-(5-iodothiophen-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-(5-iodothiophen-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 104602025 |
| Molecular Formula | C7H6IN3S2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.90 |
| IUPAC Name | 5-(5-iodothiophen-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione |
| SMILES | Cn1[nH]c(-c2csc(I)c2)nc1=S |
| InChI | InChI=1S/C7H6IN3S2/c1-11-7(12)9-6(10-11)4-2-5(8)13-3-4/h2-3H,1H3,(H,9,10,12) |
| InChIKey | INRPPHIYFWVIHQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|