C12H13Cl2N5OS — CID 104602976
N-(4-amino-2,6-dichlorophenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 104602976) has the molecular formula C12H13Cl2N5OS and a molecular weight of 346.24 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 104602976 |
| Molecular Formula | C12H13Cl2N5OS |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1ncnn1C)C(=O)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N5OS/c1-6(21-12-16-5-17-19(12)2)11(20)18-10-8(13)3-7(15)4-9(10)14/h3-6H,15H2,1-2H3,(H,18,20) |
| InChIKey | UASYZTDHINLVHF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|