C6H12N4O — CID 104605270
5-(ethoxymethyl)-2-methyl-1,2,4-triazol-3-amine (PubChem CID 104605270) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is 5-(ethoxymethyl)-2-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(ethoxymethyl)-2-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 104605270 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 5-(ethoxymethyl)-2-methyl-1,2,4-triazol-3-amine |
| SMILES | CCOCc1nc(N)n(C)n1 |
| InChI | InChI=1S/C6H12N4O/c1-3-11-4-5-8-6(7)10(2)9-5/h3-4H2,1-2H3,(H2,7,8,9) |
| InChIKey | BANWBAHLTACSKT-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |