C9H16N4S — CID 104605118
2-methyl-5-(thian-4-ylmethyl)-1,2,4-triazol-3-amine (PubChem CID 104605118) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-methyl-5-(thian-4-ylmethyl)-1,2,4-triazol-3-amine.
| Compound Name | 2-methyl-5-(thian-4-ylmethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 104605118 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-methyl-5-(thian-4-ylmethyl)-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(CC2CCSCC2)nc1N |
| InChI | InChI=1S/C9H16N4S/c1-13-9(10)11-8(12-13)6-7-2-4-14-5-3-7/h7H,2-6H2,1H3,(H2,10,11,12) |
| InChIKey | KVNQFMVVBAUXAS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |