C11H16FN3O2 — CID 104605843
7-[(5-fluoropyrimidin-2-yl)amino]heptanoic acid (PubChem CID 104605843) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is 7-[(5-fluoropyrimidin-2-yl)amino]heptanoic acid.
| Compound Name | 7-[(5-fluoropyrimidin-2-yl)amino]heptanoic acid |
|---|---|
| PubChem CID | 104605843 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 7-[(5-fluoropyrimidin-2-yl)amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNc1ncc(F)cn1 |
| InChI | InChI=1S/C11H16FN3O2/c12-9-7-14-11(15-8-9)13-6-4-2-1-3-5-10(16)17/h7-8H,1-6H2,(H,16,17)(H,13,14,15) |
| InChIKey | UIBWCMJSUSFFLM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|