C13H17ClFN3O2 — CID 91387208
2-[3-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]acetic acid (PubChem CID 91387208) has the molecular formula C13H17ClFN3O2 and a molecular weight of 301.75 g/mol. Its IUPAC name is 2-[3-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[3-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 91387208 |
| Molecular Formula | C13H17ClFN3O2 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[3-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCCC(CNc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C13H17ClFN3O2/c14-13-17-7-10(15)12(18-13)16-6-9-3-1-2-8(4-9)5-11(19)20/h7-9H,1-6H2,(H,19,20)(H,16,17,18) |
| InChIKey | OPOIXGXUIBBWOT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |