C16H23ClFN3O2 — CID 86714789
ethyl 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-(1-methylcyclohexyl)propanoate (PubChem CID 86714789) has the molecular formula C16H23ClFN3O2 and a molecular weight of 343.83 g/mol. Its IUPAC name is ethyl 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-(1-methylcyclohexyl)propanoate.
| Compound Name | ethyl 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-(1-methylcyclohexyl)propanoate |
|---|---|
| PubChem CID | 86714789 |
| Molecular Formula | C16H23ClFN3O2 |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | ethyl 3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3-(1-methylcyclohexyl)propanoate |
| SMILES | CCOC(=O)CC(Nc1nc(Cl)ncc1F)C1(C)CCCCC1 |
| InChI | InChI=1S/C16H23ClFN3O2/c1-3-23-13(22)9-12(16(2)7-5-4-6-8-16)20-14-11(18)10-19-15(17)21-14/h10,12H,3-9H2,1-2H3,(H,19,20,21) |
| InChIKey | HPPPFVUTCYVXGO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |