C11H14FN3O2 — CID 104605880
1-[(5-fluoropyrimidin-2-yl)amino]cyclohexane-1-carboxylic acid (PubChem CID 104605880) has the molecular formula C11H14FN3O2 and a molecular weight of 239.25 g/mol. Its IUPAC name is 1-[(5-fluoropyrimidin-2-yl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(5-fluoropyrimidin-2-yl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 104605880 |
| Molecular Formula | C11H14FN3O2 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-[(5-fluoropyrimidin-2-yl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(Nc2ncc(F)cn2)CCCCC1 |
| InChI | InChI=1S/C11H14FN3O2/c12-8-6-13-10(14-7-8)15-11(9(16)17)4-2-1-3-5-11/h6-7H,1-5H2,(H,16,17)(H,13,14,15) |
| InChIKey | KIQOKBJHBWAFOS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |