C11H17FN4S — CID 104606069
[1-(5-fluoropyrimidin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine (PubChem CID 104606069) has the molecular formula C11H17FN4S and a molecular weight of 256.35 g/mol. Its IUPAC name is [1-(5-fluoropyrimidin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine.
| Compound Name | [1-(5-fluoropyrimidin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 104606069 |
| Molecular Formula | C11H17FN4S |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | [1-(5-fluoropyrimidin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine |
| SMILES | CSC1(CN)CCN(c2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C11H17FN4S/c1-17-11(8-13)2-4-16(5-3-11)10-14-6-9(12)7-15-10/h6-7H,2-5,8,13H2,1H3 |
| InChIKey | RTFRZROQKHWHFG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |