C32H48O5SSi — CID 10460714
[(3S,8R,9S,10S,13S,14S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate (PubChem CID 10460714) has the molecular formula C32H48O5SSi and a molecular weight of 572.88 g/mol. Its IUPAC name is [(3S,8R,9S,10S,13S,14S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,8R,9S,10S,13S,14S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10460714 |
| Molecular Formula | C32H48O5SSi |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | [(3S,8R,9S,10S,13S,14S)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CC[C@@]3(CO[Si](C)(C)C(C)(C)C)C(=CC[C@@H]4[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C32H48O5SSi/c1-22-8-11-25(12-9-22)38(34,35)37-24-16-19-32(21-36-39(6,7)30(2,3)4)23(20-24)10-13-26-27-14-15-29(33)31(27,5)18-17-28(26)32/h8-12,24,26-28H,13-21H2,1-7H3/t24-,26-,27-,28-,31-,32+/m0/s1 |
| InChIKey | UPGPYKMWXYSATL-QXAURWLKSA-N |
| XLogP | 7.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|