C34H38N4O6Si — CID 10461622
(2S)-N-[(2S)-1-(benzylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[(1,3-dioxoisoindol-2-yl)methyl-dihydroxysilyl]methyl]-4-methylpentanamide (PubChem CID 10461622) has the molecular formula C34H38N4O6Si and a molecular weight of 626.79 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(benzylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[(1,3-dioxoisoindol-2-yl)methyl-dihydroxysilyl]methyl]-4-methylpentanamide.
| Compound Name | (2S)-N-[(2S)-1-(benzylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[(1,3-dioxoisoindol-2-yl)methyl-dihydroxysilyl]methyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 10461622 |
| Molecular Formula | C34H38N4O6Si |
| Molecular Weight | 626.79 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | (2S)-N-[(2S)-1-(benzylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-[[(1,3-dioxoisoindol-2-yl)methyl-dihydroxysilyl]methyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](C[Si](O)(O)CN1C(=O)c2ccccc2C1=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H38N4O6Si/c1-22(2)16-25(20-45(43,44)21-38-33(41)27-13-6-7-14-28(27)34(38)42)31(39)37-30(32(40)36-18-23-10-4-3-5-11-23)17-24-19-35-29-15-9-8-12-26(24)29/h3-15,19,22,25,30,35,43-44H,16-18,20-21H2,1-2H3,(H,36,40)(H,37,39)/t25-,30+/m1/s1 |
| InChIKey | NOKCHLFZWHSCFE-RNAHPLFWSA-N |
| XLogP | 3.44 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.79 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|