C10H19N3O3S — CID 104620677
3-methoxy-N-(5-propyl-1H-pyrazol-3-yl)propane-1-sulfonamide (PubChem CID 104620677) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-methoxy-N-(5-propyl-1H-pyrazol-3-yl)propane-1-sulfonamide.
| Compound Name | 3-methoxy-N-(5-propyl-1H-pyrazol-3-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 104620677 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 3-methoxy-N-(5-propyl-1H-pyrazol-3-yl)propane-1-sulfonamide |
| SMILES | CCCc1cc(NS(=O)(=O)CCCOC)n[nH]1 |
| InChI | InChI=1S/C10H19N3O3S/c1-3-5-9-8-10(12-11-9)13-17(14,15)7-4-6-16-2/h8H,3-7H2,1-2H3,(H2,11,12,13) |
| InChIKey | PCZDDALXODMQNN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|