C7H12ClN3O2S — CID 107652417
2-chloro-N-(5-ethyl-1H-pyrazol-3-yl)ethanesulfonamide (PubChem CID 107652417) has the molecular formula C7H12ClN3O2S and a molecular weight of 237.71 g/mol. Its IUPAC name is 2-chloro-N-(5-ethyl-1H-pyrazol-3-yl)ethanesulfonamide.
| Compound Name | 2-chloro-N-(5-ethyl-1H-pyrazol-3-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 107652417 |
| Molecular Formula | C7H12ClN3O2S |
| Molecular Weight | 237.71 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-chloro-N-(5-ethyl-1H-pyrazol-3-yl)ethanesulfonamide |
| SMILES | CCc1cc(NS(=O)(=O)CCCl)n[nH]1 |
| InChI | InChI=1S/C7H12ClN3O2S/c1-2-6-5-7(10-9-6)11-14(12,13)4-3-8/h5H,2-4H2,1H3,(H2,9,10,11) |
| InChIKey | BDDCSRTZEQQGGX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.71 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|