C36H37N2O6+ — CID 10462157
benzyl N-[(1S)-1-[(4R,5R)-2-methyl-5-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]-4,5-dihydro-1,3-dioxol-1-ium-4-yl]-2-phenylethyl]carbamate (PubChem CID 10462157) has the molecular formula C36H37N2O6+ and a molecular weight of 593.70 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[(4R,5R)-2-methyl-5-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]-4,5-dihydro-1,3-dioxol-1-ium-4-yl]-2-phenylethyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[(4R,5R)-2-methyl-5-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]-4,5-dihydro-1,3-dioxol-1-ium-4-yl]-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 10462157 |
| Molecular Formula | C36H37N2O6+ |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | benzyl N-[(1S)-1-[(4R,5R)-2-methyl-5-[(1S)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]-4,5-dihydro-1,3-dioxol-1-ium-4-yl]-2-phenylethyl]carbamate |
| SMILES | CC1=[O+][C@H]([C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)[C@@H]([C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C36H36N2O6/c1-26-43-33(31(22-27-14-6-2-7-15-27)37-35(39)41-24-29-18-10-4-11-19-29)34(44-26)32(23-28-16-8-3-9-17-28)38-36(40)42-25-30-20-12-5-13-21-30/h2-21,31-34H,22-25H2,1H3,(H-,37,38,39,40)/p+1/t31-,32-,33+,34+/m0/s1 |
| InChIKey | SVRWYYSBKUKKQS-PSWJWLENSA-O |
| XLogP | 5.91 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|