C30H28N2O6 — CID 1046257
N'-[2-hydroxy-2,2-bis(2-methoxyphenyl)acetyl]-N-(2-methoxyphenyl)benzohydrazide (PubChem CID 1046257) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is N'-[2-hydroxy-2,2-bis(2-methoxyphenyl)acetyl]-N-(2-methoxyphenyl)benzohydrazide.
| Compound Name | N'-[2-hydroxy-2,2-bis(2-methoxyphenyl)acetyl]-N-(2-methoxyphenyl)benzohydrazide |
|---|---|
| PubChem CID | 1046257 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | N'-[2-hydroxy-2,2-bis(2-methoxyphenyl)acetyl]-N-(2-methoxyphenyl)benzohydrazide |
| SMILES | COc1ccccc1N(NC(=O)C(O)(c1ccccc1OC)c1ccccc1OC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O6/c1-36-25-18-10-7-15-22(25)30(35,23-16-8-11-19-26(23)37-2)29(34)31-32(24-17-9-12-20-27(24)38-3)28(33)21-13-5-4-6-14-21/h4-20,35H,1-3H3,(H,31,34) |
| InChIKey | FYWNIGZFSAGFIW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|