C11H15F5N4O — CID 104632879
5-(1,1,2,2,2-pentafluoroethyl)-3-(1-piperazin-1-ylpropyl)-1,2,4-oxadiazole (PubChem CID 104632879) has the molecular formula C11H15F5N4O and a molecular weight of 314.26 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-3-(1-piperazin-1-ylpropyl)-1,2,4-oxadiazole.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-3-(1-piperazin-1-ylpropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104632879 |
| Molecular Formula | C11H15F5N4O |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-3-(1-piperazin-1-ylpropyl)-1,2,4-oxadiazole |
| SMILES | CCC(c1noc(C(F)(F)C(F)(F)F)n1)N1CCNCC1 |
| InChI | InChI=1S/C11H15F5N4O/c1-2-7(20-5-3-17-4-6-20)8-18-9(21-19-8)10(12,13)11(14,15)16/h7,17H,2-6H2,1H3 |
| InChIKey | PZBPZWSYYMCWNP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|