C11H17NO4 — CID 104644390
methyl 2-hydroxy-2-methyl-3-[(5-methylfuran-2-yl)methylamino]propanoate (PubChem CID 104644390) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 2-hydroxy-2-methyl-3-[(5-methylfuran-2-yl)methylamino]propanoate.
| Compound Name | methyl 2-hydroxy-2-methyl-3-[(5-methylfuran-2-yl)methylamino]propanoate |
|---|---|
| PubChem CID | 104644390 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | methyl 2-hydroxy-2-methyl-3-[(5-methylfuran-2-yl)methylamino]propanoate |
| SMILES | COC(=O)C(C)(O)CNCc1ccc(C)o1 |
| InChI | InChI=1S/C11H17NO4/c1-8-4-5-9(16-8)6-12-7-11(2,14)10(13)15-3/h4-5,12,14H,6-7H2,1-3H3 |
| InChIKey | WQFJOLPEXJEPQK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |