C12H18N2O3 — CID 114955525
methyl 2-hydroxy-2-methyl-3-[(4-methyl-3-pyridinyl)methylamino]propanoate (PubChem CID 114955525) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is methyl 2-hydroxy-2-methyl-3-[(4-methyl-3-pyridinyl)methylamino]propanoate.
| Compound Name | methyl 2-hydroxy-2-methyl-3-[(4-methyl-3-pyridinyl)methylamino]propanoate |
|---|---|
| PubChem CID | 114955525 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methyl 2-hydroxy-2-methyl-3-[(4-methyl-3-pyridinyl)methylamino]propanoate |
| SMILES | COC(=O)C(C)(O)CNCc1cnccc1C |
| InChI | InChI=1S/C12H18N2O3/c1-9-4-5-13-6-10(9)7-14-8-12(2,16)11(15)17-3/h4-6,14,16H,7-8H2,1-3H3 |
| InChIKey | DOSRNWCVFOXAOI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |