potassium 5-(trifluoromethyl)furan-5-id-2-one

C5H2F3KO2 — CID 10465115

IUPACpotassium 5-(trifluoromethyl)furan-5-id-2-one
SMILESO=c1cc[c-](C(F)(F)F)o1.[K+]
InChIInChI=1S/C5H2F3O2.K/c6-5(7,8)3-1-2-4(9)10-3;/h1-2H;/q-1;+1
InChIKeySAIYYQDHXOKPQU-UHFFFAOYSA-N
MW190.16 g/mol
LogP-1.62
Rot. Bonds

About potassium 5-(trifluoromethyl)furan-5-id-2-one

potassium 5-(trifluoromethyl)furan-5-id-2-one (PubChem CID 10465115) has the molecular formula C5H2F3KO2 and a molecular weight of 190.16 g/mol. Its IUPAC name is potassium 5-(trifluoromethyl)furan-5-id-2-one.

Molecular Properties

Compound Namepotassium 5-(trifluoromethyl)furan-5-id-2-one
PubChem CID10465115
Molecular FormulaC5H2F3KO2
Molecular Weight190.16 g/mol
Exact Mass189.96
IUPAC Namepotassium 5-(trifluoromethyl)furan-5-id-2-one
SMILESO=c1cc[c-](C(F)(F)F)o1.[K+]
InChIInChI=1S/C5H2F3O2.K/c6-5(7,8)3-1-2-4(9)10-3;/h1-2H;/q-1;+1
InChIKeySAIYYQDHXOKPQU-UHFFFAOYSA-N
XLogP-1.62
TPSA30.21 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 5-1.62
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze potassium 5-(trifluoromethyl)furan-5-id-2-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 5-(trifluoromethyl)furan-5-id-2-one?
The IUPAC name of potassium 5-(trifluoromethyl)furan-5-id-2-one (CID 10465115) is potassium 5-(trifluoromethyl)furan-5-id-2-one.
What is the SMILES notation for potassium 5-(trifluoromethyl)furan-5-id-2-one?
The canonical SMILES for potassium 5-(trifluoromethyl)furan-5-id-2-one is O=c1cc[c-](C(F)(F)F)o1.[K+].
What is the InChIKey of potassium 5-(trifluoromethyl)furan-5-id-2-one?
The InChIKey is SAIYYQDHXOKPQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2F3O2.K/c6-5(7,8)3-1-2-4(9)10-3;/h1-2H;/q-1;+1.
What are the key properties of potassium 5-(trifluoromethyl)furan-5-id-2-one?
potassium 5-(trifluoromethyl)furan-5-id-2-one has a molecular weight of 190.16 g/mol, XLogP of -1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-(trifluoromethyl)furan-5-id-2-one is sourced from PubChem (CID 10465115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).