About 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one
5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one (PubChem CID 57457743) has the molecular formula C7H7F3O2
and a molecular weight of 180.12 g/mol. Its IUPAC name is 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one.
Molecular Properties
| Compound Name | 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one |
| PubChem CID | 57457743 |
| Molecular Formula | C7H7F3O2 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one |
| SMILES | CC1(CC(F)(F)F)C=CC(=O)O1 |
| InChI | InChI=1S/C7H7F3O2/c1-6(4-7(8,9)10)3-2-5(11)12-6/h2-3H,4H2,1H3 |
| InChIKey | YQKLRPDBGIDXDZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one?
The IUPAC name of 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one (CID 57457743) is 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one.
What is the SMILES notation for 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one?
The canonical SMILES for 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one is CC1(CC(F)(F)F)C=CC(=O)O1.
What is the InChIKey of 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one?
The InChIKey is YQKLRPDBGIDXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3O2/c1-6(4-7(8,9)10)3-2-5(11)12-6/h2-3H,4H2,1H3.
What are the key properties of 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one?
5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one has a molecular weight of 180.12 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-(2,2,2-trifluoroethyl)furan-2-one is sourced from PubChem (CID 57457743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).