C14H21NO — CID 104655583
3-(hex-5-en-2-ylamino)-2,6-dimethylphenol (PubChem CID 104655583) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-(hex-5-en-2-ylamino)-2,6-dimethylphenol.
| Compound Name | 3-(hex-5-en-2-ylamino)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 104655583 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 3-(hex-5-en-2-ylamino)-2,6-dimethylphenol |
| SMILES | C=CCCC(C)Nc1ccc(C)c(O)c1C |
| InChI | InChI=1S/C14H21NO/c1-5-6-7-11(3)15-13-9-8-10(2)14(16)12(13)4/h5,8-9,11,15-16H,1,6-7H2,2-4H3 |
| InChIKey | OEXJNEPTXGTIES-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|