C16H19NO2 — CID 43741819
3-[1-(4-hydroxyphenyl)ethylamino]-2,6-dimethylphenol (PubChem CID 43741819) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-[1-(4-hydroxyphenyl)ethylamino]-2,6-dimethylphenol.
| Compound Name | 3-[1-(4-hydroxyphenyl)ethylamino]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 43741819 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-[1-(4-hydroxyphenyl)ethylamino]-2,6-dimethylphenol |
| SMILES | Cc1ccc(NC(C)c2ccc(O)cc2)c(C)c1O |
| InChI | InChI=1S/C16H19NO2/c1-10-4-9-15(11(2)16(10)19)17-12(3)13-5-7-14(18)8-6-13/h4-9,12,17-19H,1-3H3 |
| InChIKey | ICRONHLEZLUWLJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |