C16H19NO3 — CID 107705884
5-[1-(3-hydroxy-2,4-dimethylanilino)ethyl]benzene-1,3-diol (PubChem CID 107705884) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 5-[1-(3-hydroxy-2,4-dimethylanilino)ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-(3-hydroxy-2,4-dimethylanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107705884 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 5-[1-(3-hydroxy-2,4-dimethylanilino)ethyl]benzene-1,3-diol |
| SMILES | Cc1ccc(NC(C)c2cc(O)cc(O)c2)c(C)c1O |
| InChI | InChI=1S/C16H19NO3/c1-9-4-5-15(10(2)16(9)20)17-11(3)12-6-13(18)8-14(19)7-12/h4-8,11,17-20H,1-3H3 |
| InChIKey | WIQBBFCCNVZWLK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |