C14H12BrF3N4O4 — CID 1046560
2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-methoxy-5-nitrophenyl)acetamide (PubChem CID 1046560) has the molecular formula C14H12BrF3N4O4 and a molecular weight of 437.17 g/mol. Its IUPAC name is 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-methoxy-5-nitrophenyl)acetamide.
| Compound Name | 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-methoxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1046560 |
| Molecular Formula | C14H12BrF3N4O4 |
| Molecular Weight | 437.17 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-methoxy-5-nitrophenyl)acetamide |
| SMILES | COc1cc(NC(=O)Cn2nc(C(F)(F)F)c(Br)c2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12BrF3N4O4/c1-7-12(15)13(14(16,17)18)20-21(7)6-11(23)19-8-3-9(22(24)25)5-10(4-8)26-2/h3-5H,6H2,1-2H3,(H,19,23) |
| InChIKey | YSVDKZKWVKRSJG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.17 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|