C21H20FN5O6 — CID 12004814
4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-(4-fluorophenoxy)-5-nitrophenyl]butanamide (PubChem CID 12004814) has the molecular formula C21H20FN5O6 and a molecular weight of 457.42 g/mol. Its IUPAC name is 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-(4-fluorophenoxy)-5-nitrophenyl]butanamide.
| Compound Name | 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-(4-fluorophenoxy)-5-nitrophenyl]butanamide |
|---|---|
| PubChem CID | 12004814 |
| Molecular Formula | C21H20FN5O6 |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[3-(4-fluorophenoxy)-5-nitrophenyl]butanamide |
| SMILES | Cc1nn(CCCC(=O)Nc2cc(Oc3ccc(F)cc3)cc([N+](=O)[O-])c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20FN5O6/c1-13-21(27(31)32)14(2)25(24-13)9-3-4-20(28)23-16-10-17(26(29)30)12-19(11-16)33-18-7-5-15(22)6-8-18/h5-8,10-12H,3-4,9H2,1-2H3,(H,23,28) |
| InChIKey | REONAWLRUKUCKW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|