C14H24O2S — CID 104656218
2-(6-oxa-2-thiaspiro[4.5]decan-9-yl)hex-5-en-2-ol (PubChem CID 104656218) has the molecular formula C14H24O2S and a molecular weight of 256.41 g/mol. Its IUPAC name is 2-(6-oxa-2-thiaspiro[4.5]decan-9-yl)hex-5-en-2-ol.
| Compound Name | 2-(6-oxa-2-thiaspiro[4.5]decan-9-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 104656218 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-(6-oxa-2-thiaspiro[4.5]decan-9-yl)hex-5-en-2-ol |
| SMILES | C=CCCC(C)(O)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C14H24O2S/c1-3-4-6-13(2,15)12-5-8-16-14(10-12)7-9-17-11-14/h3,12,15H,1,4-11H2,2H3 |
| InChIKey | YHFXEXRJVVPZOR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|