C17H26BrClO — CID 104661921
2-bromo-4-(1-chloro-3,4,4-trimethylpentyl)-1-propoxybenzene (PubChem CID 104661921) has the molecular formula C17H26BrClO and a molecular weight of 361.75 g/mol. Its IUPAC name is 2-bromo-4-(1-chloro-3,4,4-trimethylpentyl)-1-propoxybenzene.
| Compound Name | 2-bromo-4-(1-chloro-3,4,4-trimethylpentyl)-1-propoxybenzene |
|---|---|
| PubChem CID | 104661921 |
| Molecular Formula | C17H26BrClO |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-bromo-4-(1-chloro-3,4,4-trimethylpentyl)-1-propoxybenzene |
| SMILES | CCCOc1ccc(C(Cl)CC(C)C(C)(C)C)cc1Br |
| InChI | InChI=1S/C17H26BrClO/c1-6-9-20-16-8-7-13(11-14(16)18)15(19)10-12(2)17(3,4)5/h7-8,11-12,15H,6,9-10H2,1-5H3 |
| InChIKey | HXSLXGFMQWAIOH-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|