C15H24BrNO — CID 113438088
1-(3-bromo-4-propoxyphenyl)-3,3-dimethylbutan-1-amine (PubChem CID 113438088) has the molecular formula C15H24BrNO and a molecular weight of 314.27 g/mol. Its IUPAC name is 1-(3-bromo-4-propoxyphenyl)-3,3-dimethylbutan-1-amine.
| Compound Name | 1-(3-bromo-4-propoxyphenyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 113438088 |
| Molecular Formula | C15H24BrNO |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(3-bromo-4-propoxyphenyl)-3,3-dimethylbutan-1-amine |
| SMILES | CCCOc1ccc(C(N)CC(C)(C)C)cc1Br |
| InChI | InChI=1S/C15H24BrNO/c1-5-8-18-14-7-6-11(9-12(14)16)13(17)10-15(2,3)4/h6-7,9,13H,5,8,10,17H2,1-4H3 |
| InChIKey | PUMDMROEKPDFOX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |