C16H17BrINO — CID 104657896
(3-bromo-4-propoxyphenyl)-(4-iodophenyl)methanamine (PubChem CID 104657896) has the molecular formula C16H17BrINO and a molecular weight of 446.13 g/mol. Its IUPAC name is (3-bromo-4-propoxyphenyl)-(4-iodophenyl)methanamine.
| Compound Name | (3-bromo-4-propoxyphenyl)-(4-iodophenyl)methanamine |
|---|---|
| PubChem CID | 104657896 |
| Molecular Formula | C16H17BrINO |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 444.95 |
| IUPAC Name | (3-bromo-4-propoxyphenyl)-(4-iodophenyl)methanamine |
| SMILES | CCCOc1ccc(C(N)c2ccc(I)cc2)cc1Br |
| InChI | InChI=1S/C16H17BrINO/c1-2-9-20-15-8-5-12(10-14(15)17)16(19)11-3-6-13(18)7-4-11/h3-8,10,16H,2,9,19H2,1H3 |
| InChIKey | ICDTYNWVTPMXOH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|