C12H13BrF5NO — CID 104657853
1-(3-bromo-4-propoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 104657853) has the molecular formula C12H13BrF5NO and a molecular weight of 362.14 g/mol. Its IUPAC name is 1-(3-bromo-4-propoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | 1-(3-bromo-4-propoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 104657853 |
| Molecular Formula | C12H13BrF5NO |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-(3-bromo-4-propoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | CCCOc1ccc(C(N)C(F)(F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C12H13BrF5NO/c1-2-5-20-9-4-3-7(6-8(9)13)10(19)11(14,15)12(16,17)18/h3-4,6,10H,2,5,19H2,1H3 |
| InChIKey | WIGLDVYYQIIVPM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|