C11H20N4 — CID 104670250
N'-[(3-ethyl-6-methylpyridazin-4-yl)methyl]propane-1,3-diamine (PubChem CID 104670250) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N'-[(3-ethyl-6-methylpyridazin-4-yl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(3-ethyl-6-methylpyridazin-4-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 104670250 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N'-[(3-ethyl-6-methylpyridazin-4-yl)methyl]propane-1,3-diamine |
| SMILES | CCc1nnc(C)cc1CNCCCN |
| InChI | InChI=1S/C11H20N4/c1-3-11-10(7-9(2)14-15-11)8-13-6-4-5-12/h7,13H,3-6,8,12H2,1-2H3 |
| InChIKey | PZEKZWQTYLOZAJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|