C9H12BrN3O — CID 104672670
N-(1-bromobutan-2-yl)pyridazine-4-carboxamide (PubChem CID 104672670) has the molecular formula C9H12BrN3O and a molecular weight of 258.12 g/mol. Its IUPAC name is N-(1-bromobutan-2-yl)pyridazine-4-carboxamide.
| Compound Name | N-(1-bromobutan-2-yl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104672670 |
| Molecular Formula | C9H12BrN3O |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | N-(1-bromobutan-2-yl)pyridazine-4-carboxamide |
| SMILES | CCC(CBr)NC(=O)c1ccnnc1 |
| InChI | InChI=1S/C9H12BrN3O/c1-2-8(5-10)13-9(14)7-3-4-11-12-6-7/h3-4,6,8H,2,5H2,1H3,(H,13,14) |
| InChIKey | YGPZXNRXEOEEPJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|