C14H21N5S — CID 104672993
3-[5-(3,6-dimethylpyridazin-4-yl)-1,3,4-thiadiazol-2-yl]-N-propan-2-ylpropan-1-amine (PubChem CID 104672993) has the molecular formula C14H21N5S and a molecular weight of 291.42 g/mol. Its IUPAC name is 3-[5-(3,6-dimethylpyridazin-4-yl)-1,3,4-thiadiazol-2-yl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[5-(3,6-dimethylpyridazin-4-yl)-1,3,4-thiadiazol-2-yl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 104672993 |
| Molecular Formula | C14H21N5S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-[5-(3,6-dimethylpyridazin-4-yl)-1,3,4-thiadiazol-2-yl]-N-propan-2-ylpropan-1-amine |
| SMILES | Cc1cc(-c2nnc(CCCNC(C)C)s2)c(C)nn1 |
| InChI | InChI=1S/C14H21N5S/c1-9(2)15-7-5-6-13-18-19-14(20-13)12-8-10(3)16-17-11(12)4/h8-9,15H,5-7H2,1-4H3 |
| InChIKey | KKHUERNLENGRTA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|