C10H11ClN4S — CID 104672958
2-(1-chloroethyl)-5-(3,6-dimethylpyridazin-4-yl)-1,3,4-thiadiazole (PubChem CID 104672958) has the molecular formula C10H11ClN4S and a molecular weight of 254.75 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-(3,6-dimethylpyridazin-4-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(1-chloroethyl)-5-(3,6-dimethylpyridazin-4-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 104672958 |
| Molecular Formula | C10H11ClN4S |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(1-chloroethyl)-5-(3,6-dimethylpyridazin-4-yl)-1,3,4-thiadiazole |
| SMILES | Cc1cc(-c2nnc(C(C)Cl)s2)c(C)nn1 |
| InChI | InChI=1S/C10H11ClN4S/c1-5-4-8(7(3)13-12-5)10-15-14-9(16-10)6(2)11/h4,6H,1-3H3 |
| InChIKey | GNYLPKVTGVDZIF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|