C17H25BrO2 — CID 104673759
1-(3-bromo-2-methoxycyclobutyl)oxy-2-tert-butyl-4-ethylbenzene (PubChem CID 104673759) has the molecular formula C17H25BrO2 and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-(3-bromo-2-methoxycyclobutyl)oxy-2-tert-butyl-4-ethylbenzene.
| Compound Name | 1-(3-bromo-2-methoxycyclobutyl)oxy-2-tert-butyl-4-ethylbenzene |
|---|---|
| PubChem CID | 104673759 |
| Molecular Formula | C17H25BrO2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-(3-bromo-2-methoxycyclobutyl)oxy-2-tert-butyl-4-ethylbenzene |
| SMILES | CCc1ccc(OC2CC(Br)C2OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H25BrO2/c1-6-11-7-8-14(12(9-11)17(2,3)4)20-15-10-13(18)16(15)19-5/h7-9,13,15-16H,6,10H2,1-5H3 |
| InChIKey | ZHLRRMTTWXWXSO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|