C11H11BrF2O2 — CID 104674085
1-(3-bromo-2-methoxycyclobutyl)oxy-2,3-difluorobenzene (PubChem CID 104674085) has the molecular formula C11H11BrF2O2 and a molecular weight of 293.11 g/mol. Its IUPAC name is 1-(3-bromo-2-methoxycyclobutyl)oxy-2,3-difluorobenzene.
| Compound Name | 1-(3-bromo-2-methoxycyclobutyl)oxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 104674085 |
| Molecular Formula | C11H11BrF2O2 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 1-(3-bromo-2-methoxycyclobutyl)oxy-2,3-difluorobenzene |
| SMILES | COC1C(Br)CC1Oc1cccc(F)c1F |
| InChI | InChI=1S/C11H11BrF2O2/c1-15-11-6(12)5-9(11)16-8-4-2-3-7(13)10(8)14/h2-4,6,9,11H,5H2,1H3 |
| InChIKey | SECFRNXDCBMYHL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|