C14H19BrO4 — CID 104675482
2-(3-bromo-2-ethoxycyclobutyl)oxy-1,3-dimethoxybenzene (PubChem CID 104675482) has the molecular formula C14H19BrO4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-(3-bromo-2-ethoxycyclobutyl)oxy-1,3-dimethoxybenzene.
| Compound Name | 2-(3-bromo-2-ethoxycyclobutyl)oxy-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 104675482 |
| Molecular Formula | C14H19BrO4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-(3-bromo-2-ethoxycyclobutyl)oxy-1,3-dimethoxybenzene |
| SMILES | CCOC1C(Br)CC1Oc1c(OC)cccc1OC |
| InChI | InChI=1S/C14H19BrO4/c1-4-18-13-9(15)8-12(13)19-14-10(16-2)6-5-7-11(14)17-3/h5-7,9,12-13H,4,8H2,1-3H3 |
| InChIKey | FJTXQOZWNWALNA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|