C13H15BrF2O2 — CID 114276832
1-(3-bromo-2-ethoxycyclobutyl)oxy-4,5-difluoro-2-methylbenzene (PubChem CID 114276832) has the molecular formula C13H15BrF2O2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 1-(3-bromo-2-ethoxycyclobutyl)oxy-4,5-difluoro-2-methylbenzene.
| Compound Name | 1-(3-bromo-2-ethoxycyclobutyl)oxy-4,5-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 114276832 |
| Molecular Formula | C13H15BrF2O2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 1-(3-bromo-2-ethoxycyclobutyl)oxy-4,5-difluoro-2-methylbenzene |
| SMILES | CCOC1C(Br)CC1Oc1cc(F)c(F)cc1C |
| InChI | InChI=1S/C13H15BrF2O2/c1-3-17-13-8(14)5-12(13)18-11-6-10(16)9(15)4-7(11)2/h4,6,8,12-13H,3,5H2,1-2H3 |
| InChIKey | CRCOZSQZMHKBKZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|