C11H19N5O2 — CID 10467447
8-amino-1,3-dipropyl-5,7-dihydro-4H-purine-2,6-dione (PubChem CID 10467447) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 8-amino-1,3-dipropyl-5,7-dihydro-4H-purine-2,6-dione.
| Compound Name | 8-amino-1,3-dipropyl-5,7-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 10467447 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 8-amino-1,3-dipropyl-5,7-dihydro-4H-purine-2,6-dione |
| SMILES | CCCN1C(=O)C2NC(N)=NC2N(CCC)C1=O |
| InChI | InChI=1S/C11H19N5O2/c1-3-5-15-8-7(13-10(12)14-8)9(17)16(6-4-2)11(15)18/h7-8H,3-6H2,1-2H3,(H3,12,13,14) |
| InChIKey | HSVAICCOLMJETQ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |