C15H20O6 — CID 104675265
2-ethoxy-3-(3,4,5-trimethoxyphenoxy)cyclobutan-1-one (PubChem CID 104675265) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-ethoxy-3-(3,4,5-trimethoxyphenoxy)cyclobutan-1-one.
| Compound Name | 2-ethoxy-3-(3,4,5-trimethoxyphenoxy)cyclobutan-1-one |
|---|---|
| PubChem CID | 104675265 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-ethoxy-3-(3,4,5-trimethoxyphenoxy)cyclobutan-1-one |
| SMILES | CCOC1C(=O)CC1Oc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H20O6/c1-5-20-14-10(16)8-13(14)21-9-6-11(17-2)15(19-4)12(7-9)18-3/h6-7,13-14H,5,8H2,1-4H3 |
| InChIKey | DMHXYNUMJZGJLQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |