About 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene
5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene (PubChem CID 104675915) has the molecular formula C15H21ClO5
and a molecular weight of 316.78 g/mol. Its IUPAC name is 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene.
Molecular Properties
| Compound Name | 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene |
| PubChem CID | 104675915 |
| Molecular Formula | C15H21ClO5 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene |
| SMILES | CCOC1C(Cl)CC1Oc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21ClO5/c1-5-20-14-10(16)8-13(14)21-9-6-11(17-2)15(19-4)12(7-9)18-3/h6-7,10,13-14H,5,8H2,1-4H3 |
| InChIKey | FMCDKHLJZDEZBX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene?
The IUPAC name of 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene (CID 104675915) is 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene.
What is the SMILES notation for 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene?
The canonical SMILES for 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene is CCOC1C(Cl)CC1Oc1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene?
The InChIKey is FMCDKHLJZDEZBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO5/c1-5-20-14-10(16)8-13(14)21-9-6-11(17-2)15(19-4)12(7-9)18-3/h6-7,10,13-14H,5,8H2,1-4H3.
What are the key properties of 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene?
5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene has a molecular weight of 316.78 g/mol, XLogP of 2.88, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chloro-2-ethoxycyclobutyl)oxy-1,2,3-trimethoxybenzene is sourced from PubChem (CID 104675915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).