C10H12N+ — CID 10467998
1-methyl-2,3-dihydroquinolin-1-ium (PubChem CID 10467998) has the molecular formula C10H12N+ and a molecular weight of 146.21 g/mol. Its IUPAC name is 1-methyl-2,3-dihydroquinolin-1-ium.
| Compound Name | 1-methyl-2,3-dihydroquinolin-1-ium |
|---|---|
| PubChem CID | 10467998 |
| Molecular Formula | C10H12N+ |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.10 |
| IUPAC Name | 1-methyl-2,3-dihydroquinolin-1-ium |
| SMILES | C[N+]1=c2ccccc2=CCC1 |
| InChI | InChI=1S/C10H12N/c1-11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5-7H,4,8H2,1H3/q+1 |
| InChIKey | CUDDMFLTAQMVRO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|