About 10-methyl-4a,9a-dihydroacridin-10-ium
10-methyl-4a,9a-dihydroacridin-10-ium (PubChem CID 135024985) has the molecular formula C14H14N+
and a molecular weight of 196.27 g/mol. Its IUPAC name is 10-methyl-4a,9a-dihydroacridin-10-ium.
Molecular Properties
| Compound Name | 10-methyl-4a,9a-dihydroacridin-10-ium |
| PubChem CID | 135024985 |
| Molecular Formula | C14H14N+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 10-methyl-4a,9a-dihydroacridin-10-ium |
| SMILES | C[N+]1=c2ccccc2=CC2C=CC=CC21 |
| InChI | InChI=1S/C14H14N/c1-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15/h2-11,13H,1H3/q+1 |
| InChIKey | IJHVTIWDJXTNLX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 10-methyl-4a,9a-dihydroacridin-10-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-4a,9a-dihydroacridin-10-ium?
The IUPAC name of 10-methyl-4a,9a-dihydroacridin-10-ium (CID 135024985) is 10-methyl-4a,9a-dihydroacridin-10-ium.
What is the SMILES notation for 10-methyl-4a,9a-dihydroacridin-10-ium?
The canonical SMILES for 10-methyl-4a,9a-dihydroacridin-10-ium is C[N+]1=c2ccccc2=CC2C=CC=CC21.
What is the InChIKey of 10-methyl-4a,9a-dihydroacridin-10-ium?
The InChIKey is IJHVTIWDJXTNLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N/c1-15-13-8-4-2-6-11(13)10-12-7-3-5-9-14(12)15/h2-11,13H,1H3/q+1.
What are the key properties of 10-methyl-4a,9a-dihydroacridin-10-ium?
10-methyl-4a,9a-dihydroacridin-10-ium has a molecular weight of 196.27 g/mol, XLogP of 0.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-4a,9a-dihydroacridin-10-ium is sourced from PubChem (CID 135024985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).